C25H26Cl2N4O4 — CID 137140805
ethyl (7S)-7-[4-[(2,4-dichlorophenyl)methoxy]-3-methoxyphenyl]-5-propyl-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxylate (PubChem CID 137140805) has the molecular formula C25H26Cl2N4O4 and a molecular weight of 517.41 g/mol. Its IUPAC name is ethyl (7S)-7-[4-[(2,4-dichlorophenyl)methoxy]-3-methoxyphenyl]-5-propyl-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxylate.
| Compound Name | ethyl (7S)-7-[4-[(2,4-dichlorophenyl)methoxy]-3-methoxyphenyl]-5-propyl-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxylate |
|---|---|
| PubChem CID | 137140805 |
| Molecular Formula | C25H26Cl2N4O4 |
| Molecular Weight | 517.41 g/mol |
| Exact Mass | 516.13 |
| IUPAC Name | ethyl (7S)-7-[4-[(2,4-dichlorophenyl)methoxy]-3-methoxyphenyl]-5-propyl-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxylate |
| SMILES | CCCC1=C(C(=O)OCC)[C@H](c2ccc(OCc3ccc(Cl)cc3Cl)c(OC)c2)n2ncnc2N1 |
| InChI | InChI=1S/C25H26Cl2N4O4/c1-4-6-19-22(24(32)34-5-2)23(31-25(30-19)28-14-29-31)15-8-10-20(21(11-15)33-3)35-13-16-7-9-17(26)12-18(16)27/h7-12,14,23H,4-6,13H2,1-3H3,(H,28,29,30)/t23-/m0/s1 |
| InChIKey | MIEHSJHWPJJJSF-QHCPKHFHSA-N |
| XLogP | 5.80 |
| TPSA | 87.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.41 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |