C19H25N5O3 — CID 137140921
4-[(4-oxo-3H-quinazolin-2-yl)methyl]-N-piperidin-3-ylmorpholine-2-carboxamide (PubChem CID 137140921) has the molecular formula C19H25N5O3 and a molecular weight of 371.44 g/mol. Its IUPAC name is 4-[(4-oxo-3H-quinazolin-2-yl)methyl]-N-piperidin-3-ylmorpholine-2-carboxamide.
| Compound Name | 4-[(4-oxo-3H-quinazolin-2-yl)methyl]-N-piperidin-3-ylmorpholine-2-carboxamide |
|---|---|
| PubChem CID | 137140921 |
| Molecular Formula | C19H25N5O3 |
| Molecular Weight | 371.44 g/mol |
| Exact Mass | 371.20 |
| IUPAC Name | 4-[(4-oxo-3H-quinazolin-2-yl)methyl]-N-piperidin-3-ylmorpholine-2-carboxamide |
| SMILES | O=C(NC1CCCNC1)C1CN(Cc2nc3ccccc3c(=O)[nH]2)CCO1 |
| InChI | InChI=1S/C19H25N5O3/c25-18-14-5-1-2-6-15(14)22-17(23-18)12-24-8-9-27-16(11-24)19(26)21-13-4-3-7-20-10-13/h1-2,5-6,13,16,20H,3-4,7-12H2,(H,21,26)(H,22,23,25) |
| InChIKey | UQXMBQLCJYFEBR-UHFFFAOYSA-N |
| XLogP | -0.01 |
| TPSA | 99.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.44 |
| LogP ≤ 5 | -0.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |