C21H20N4OS2 — CID 137141138
2-[(6-methyl-15-thia-2,6,12-triazatetracyclo[8.5.0.03,8.011,14]pentadeca-1(10),2,8,11(14)-tetraen-13-ylidene)amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carbaldehyde (PubChem CID 137141138) has the molecular formula C21H20N4OS2 and a molecular weight of 408.55 g/mol. Its IUPAC name is 2-[(6-methyl-15-thia-2,6,12-triazatetracyclo[8.5.0.03,8.011,14]pentadeca-1(10),2,8,11(14)-tetraen-13-ylidene)amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carbaldehyde.
| Compound Name | 2-[(6-methyl-15-thia-2,6,12-triazatetracyclo[8.5.0.03,8.011,14]pentadeca-1(10),2,8,11(14)-tetraen-13-ylidene)amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carbaldehyde |
|---|---|
| PubChem CID | 137141138 |
| Molecular Formula | C21H20N4OS2 |
| Molecular Weight | 408.55 g/mol |
| Exact Mass | 408.11 |
| IUPAC Name | 2-[(6-methyl-15-thia-2,6,12-triazatetracyclo[8.5.0.03,8.011,14]pentadeca-1(10),2,8,11(14)-tetraen-13-ylidene)amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carbaldehyde |
| SMILES | CN1CCc2nc3sc4c(c3cc2C1)NC4=Nc1sc2c(c1C=O)CCCC2 |
| InChI | InChI=1S/C21H20N4OS2/c1-25-7-6-15-11(9-25)8-13-17-18(28-20(13)22-15)19(23-17)24-21-14(10-26)12-4-2-3-5-16(12)27-21/h8,10H,2-7,9H2,1H3,(H,23,24) |
| InChIKey | WGUDRBXGQWCIBP-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 57.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.55 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|