C23H24ClN5O3 — CID 137142936
N-[7-[2-[3-(5-chloro-2-hydroxyphenyl)-6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-7-yl]ethoxy]-2,3-dihydro-1H-inden-4-yl]formamide (PubChem CID 137142936) has the molecular formula C23H24ClN5O3 and a molecular weight of 453.93 g/mol. Its IUPAC name is N-[7-[2-[3-(5-chloro-2-hydroxyphenyl)-6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-7-yl]ethoxy]-2,3-dihydro-1H-inden-4-yl]formamide.
| Compound Name | N-[7-[2-[3-(5-chloro-2-hydroxyphenyl)-6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-7-yl]ethoxy]-2,3-dihydro-1H-inden-4-yl]formamide |
|---|---|
| PubChem CID | 137142936 |
| Molecular Formula | C23H24ClN5O3 |
| Molecular Weight | 453.93 g/mol |
| Exact Mass | 453.16 |
| IUPAC Name | N-[7-[2-[3-(5-chloro-2-hydroxyphenyl)-6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-7-yl]ethoxy]-2,3-dihydro-1H-inden-4-yl]formamide |
| SMILES | O=CNc1ccc(OCCN2CCn3c(nnc3-c3cc(Cl)ccc3O)C2)c2c1CCC2 |
| InChI | InChI=1S/C23H24ClN5O3/c24-15-4-6-20(31)18(12-15)23-27-26-22-13-28(8-9-29(22)23)10-11-32-21-7-5-19(25-14-30)16-2-1-3-17(16)21/h4-7,12,14,31H,1-3,8-11,13H2,(H,25,30) |
| InChIKey | CTZUVSOUALNLJL-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 92.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.93 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|