C18H23NO4 — CID 137143399
2-(3-hydroxy-3-methylbutyl)-5,6-dimethyl-3-[2-(1,3-oxazol-2-yl)ethenyl]benzene-1,4-diol (PubChem CID 137143399) has the molecular formula C18H23NO4 and a molecular weight of 317.39 g/mol. Its IUPAC name is 2-(3-hydroxy-3-methylbutyl)-5,6-dimethyl-3-[2-(1,3-oxazol-2-yl)ethenyl]benzene-1,4-diol.
| Compound Name | 2-(3-hydroxy-3-methylbutyl)-5,6-dimethyl-3-[2-(1,3-oxazol-2-yl)ethenyl]benzene-1,4-diol |
|---|---|
| PubChem CID | 137143399 |
| Molecular Formula | C18H23NO4 |
| Molecular Weight | 317.39 g/mol |
| Exact Mass | 317.16 |
| IUPAC Name | 2-(3-hydroxy-3-methylbutyl)-5,6-dimethyl-3-[2-(1,3-oxazol-2-yl)ethenyl]benzene-1,4-diol |
| SMILES | Cc1c(C)c(O)c(CCC(C)(C)O)c(C=Cc2ncco2)c1O |
| InChI | InChI=1S/C18H23NO4/c1-11-12(2)17(21)14(7-8-18(3,4)22)13(16(11)20)5-6-15-19-9-10-23-15/h5-6,9-10,20-22H,7-8H2,1-4H3 |
| InChIKey | RIONHTDLRMCQFJ-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 86.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.39 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|