C21H25N7O — CID 137144018
1-cyclohexyl-3-[4-[(2-iminoethyldiazenyl)methyl]anilino]-5H-pyrazolo[4,3-c]pyridin-4-one (PubChem CID 137144018) has the molecular formula C21H25N7O and a molecular weight of 391.48 g/mol. Its IUPAC name is 1-cyclohexyl-3-[4-[(2-iminoethyldiazenyl)methyl]anilino]-5H-pyrazolo[4,3-c]pyridin-4-one.
| Compound Name | 1-cyclohexyl-3-[4-[(2-iminoethyldiazenyl)methyl]anilino]-5H-pyrazolo[4,3-c]pyridin-4-one |
|---|---|
| PubChem CID | 137144018 |
| Molecular Formula | C21H25N7O |
| Molecular Weight | 391.48 g/mol |
| Exact Mass | 391.21 |
| IUPAC Name | 1-cyclohexyl-3-[4-[(2-iminoethyldiazenyl)methyl]anilino]-5H-pyrazolo[4,3-c]pyridin-4-one |
| SMILES | [H]/N=C/C/N=N/Cc1ccc(Nc2nn(C3CCCCC3)c3cc[nH]c(=O)c23)cc1 |
| InChI | InChI=1S/C21H25N7O/c22-11-13-24-25-14-15-6-8-16(9-7-15)26-20-19-18(10-12-23-21(19)29)28(27-20)17-4-2-1-3-5-17/h6-12,17,22H,1-5,13-14H2,(H,23,29)(H,26,27)/b22-11+,25-24+ |
| InChIKey | HYSRZYMOEUKIOL-KKODSAQRSA-N |
| XLogP | 4.58 |
| TPSA | 111.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.48 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|