C24H19BrFN5O4S — CID 137144452
2-[[5-(5-bromo-2-hydroxyphenyl)-4-(2,4-dimethylphenyl)-1,2,4-triazol-3-yl]sulfanyl]-N-(4-fluoro-3-nitrophenyl)acetamide (PubChem CID 137144452) has the molecular formula C24H19BrFN5O4S and a molecular weight of 572.42 g/mol. Its IUPAC name is 2-[[5-(5-bromo-2-hydroxyphenyl)-4-(2,4-dimethylphenyl)-1,2,4-triazol-3-yl]sulfanyl]-N-(4-fluoro-3-nitrophenyl)acetamide.
| Compound Name | 2-[[5-(5-bromo-2-hydroxyphenyl)-4-(2,4-dimethylphenyl)-1,2,4-triazol-3-yl]sulfanyl]-N-(4-fluoro-3-nitrophenyl)acetamide |
|---|---|
| PubChem CID | 137144452 |
| Molecular Formula | C24H19BrFN5O4S |
| Molecular Weight | 572.42 g/mol |
| Exact Mass | 571.03 |
| IUPAC Name | 2-[[5-(5-bromo-2-hydroxyphenyl)-4-(2,4-dimethylphenyl)-1,2,4-triazol-3-yl]sulfanyl]-N-(4-fluoro-3-nitrophenyl)acetamide |
| SMILES | Cc1ccc(-n2c(SCC(=O)Nc3ccc(F)c([N+](=O)[O-])c3)nnc2-c2cc(Br)ccc2O)c(C)c1 |
| InChI | InChI=1S/C24H19BrFN5O4S/c1-13-3-7-19(14(2)9-13)30-23(17-10-15(25)4-8-21(17)32)28-29-24(30)36-12-22(33)27-16-5-6-18(26)20(11-16)31(34)35/h3-11,32H,12H2,1-2H3,(H,27,33) |
| InChIKey | DSJHUWJVJXPLFM-UHFFFAOYSA-N |
| XLogP | 5.80 |
| TPSA | 123.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.42 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|