C16H16N8O — CID 137145491
6-[4-(3-isocyano-2-pyridinyl)piperazin-1-yl]-1-methyl-5H-pyrazolo[5,4-d]pyrimidin-4-one (PubChem CID 137145491) has the molecular formula C16H16N8O and a molecular weight of 336.36 g/mol. Its IUPAC name is 6-[4-(3-isocyano-2-pyridinyl)piperazin-1-yl]-1-methyl-5H-pyrazolo[5,4-d]pyrimidin-4-one.
| Compound Name | 6-[4-(3-isocyano-2-pyridinyl)piperazin-1-yl]-1-methyl-5H-pyrazolo[5,4-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 137145491 |
| Molecular Formula | C16H16N8O |
| Molecular Weight | 336.36 g/mol |
| Exact Mass | 336.14 |
| IUPAC Name | 6-[4-(3-isocyano-2-pyridinyl)piperazin-1-yl]-1-methyl-5H-pyrazolo[5,4-d]pyrimidin-4-one |
| SMILES | [C-]#[N+]c1cccnc1N1CCN(c2nc3c(cnn3C)c(=O)[nH]2)CC1 |
| InChI | InChI=1S/C16H16N8O/c1-17-12-4-3-5-18-14(12)23-6-8-24(9-7-23)16-20-13-11(15(25)21-16)10-19-22(13)2/h3-5,10H,6-9H2,2H3,(H,20,21,25) |
| InChIKey | OQGUUWCECFFZOR-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.36 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|