C21H20N2O2S — CID 137145826
(5E)-5-[(2,2-dimethyl-3H-1-benzofuran-5-yl)methylidene]-2-(4-methylphenyl)imino-1,3-thiazolidin-4-one (PubChem CID 137145826) has the molecular formula C21H20N2O2S and a molecular weight of 364.47 g/mol. Its IUPAC name is (5E)-5-[(2,2-dimethyl-3H-1-benzofuran-5-yl)methylidene]-2-(4-methylphenyl)imino-1,3-thiazolidin-4-one.
| Compound Name | (5E)-5-[(2,2-dimethyl-3H-1-benzofuran-5-yl)methylidene]-2-(4-methylphenyl)imino-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 137145826 |
| Molecular Formula | C21H20N2O2S |
| Molecular Weight | 364.47 g/mol |
| Exact Mass | 364.12 |
| IUPAC Name | (5E)-5-[(2,2-dimethyl-3H-1-benzofuran-5-yl)methylidene]-2-(4-methylphenyl)imino-1,3-thiazolidin-4-one |
| SMILES | Cc1ccc(/N=C2/NC(=O)/C(=C\c3ccc4c(c3)CC(C)(C)O4)S2)cc1 |
| InChI | InChI=1S/C21H20N2O2S/c1-13-4-7-16(8-5-13)22-20-23-19(24)18(26-20)11-14-6-9-17-15(10-14)12-21(2,3)25-17/h4-11H,12H2,1-3H3,(H,22,23,24)/b18-11+ |
| InChIKey | JDZJEMHAKSJTKY-WOJGMQOQSA-N |
| XLogP | 4.60 |
| TPSA | 50.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.47 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|