C17H12Cl2F2N2OTi — CID 137145948
dichlorotitanium;2-(3,5-difluorophenyl)-6-(pyrrol-1-yliminomethyl)phenol (PubChem CID 137145948) has the molecular formula C17H12Cl2F2N2OTi and a molecular weight of 417.07 g/mol. Its IUPAC name is dichlorotitanium;2-(3,5-difluorophenyl)-6-(pyrrol-1-yliminomethyl)phenol.
| Compound Name | dichlorotitanium;2-(3,5-difluorophenyl)-6-(pyrrol-1-yliminomethyl)phenol |
|---|---|
| PubChem CID | 137145948 |
| Molecular Formula | C17H12Cl2F2N2OTi |
| Molecular Weight | 417.07 g/mol |
| Exact Mass | 415.98 |
| IUPAC Name | dichlorotitanium;2-(3,5-difluorophenyl)-6-(pyrrol-1-yliminomethyl)phenol |
| SMILES | Cl[Ti]Cl.Oc1c(C=Nn2cccc2)cccc1-c1cc(F)cc(F)c1 |
| InChI | InChI=1S/C17H12F2N2O.2ClH.Ti/c18-14-8-13(9-15(19)10-14)16-5-3-4-12(17(16)22)11-20-21-6-1-2-7-21;;;/h1-11,22H;2*1H;/q;;;+2/p-2 |
| InChIKey | IDZXOWUXSOIXIH-UHFFFAOYSA-L |
| XLogP | 5.40 |
| TPSA | 37.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.07 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|