About 2-aminospiro[1H-pyrimido[1,2-a]benzimidazole-4,1'-cyclopentane]-3-carbonitrile
2-aminospiro[1H-pyrimido[1,2-a]benzimidazole-4,1'-cyclopentane]-3-carbonitrile (PubChem CID 137147616) has the molecular formula C15H15N5
and a molecular weight of 265.32 g/mol. Its IUPAC name is 2-aminospiro[1H-pyrimido[1,2-a]benzimidazole-4,1'-cyclopentane]-3-carbonitrile.
Molecular Properties
| Compound Name | 2-aminospiro[1H-pyrimido[1,2-a]benzimidazole-4,1'-cyclopentane]-3-carbonitrile |
| PubChem CID | 137147616 |
| Molecular Formula | C15H15N5 |
| Molecular Weight | 265.32 g/mol |
| Exact Mass | 265.13 |
| IUPAC Name | 2-aminospiro[1H-pyrimido[1,2-a]benzimidazole-4,1'-cyclopentane]-3-carbonitrile |
| SMILES | N#CC1=C(N)Nc2nc3ccccc3n2C12CCCC2 |
| InChI | InChI=1S/C15H15N5/c16-9-10-13(17)19-14-18-11-5-1-2-6-12(11)20(14)15(10)7-3-4-8-15/h1-2,5-6H,3-4,7-8,17H2,(H,18,19) |
| InChIKey | FJXYISIQQRDRBC-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 79.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 265.32 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-aminospiro[1H-pyrimido[1,2-a]benzimidazole-4,1'-cyclopentane]-3-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-aminospiro[1H-pyrimido[1,2-a]benzimidazole-4,1'-cyclopentane]-3-carbonitrile?
The IUPAC name of 2-aminospiro[1H-pyrimido[1,2-a]benzimidazole-4,1'-cyclopentane]-3-carbonitrile (CID 137147616) is 2-aminospiro[1H-pyrimido[1,2-a]benzimidazole-4,1'-cyclopentane]-3-carbonitrile.
What is the SMILES notation for 2-aminospiro[1H-pyrimido[1,2-a]benzimidazole-4,1'-cyclopentane]-3-carbonitrile?
The canonical SMILES for 2-aminospiro[1H-pyrimido[1,2-a]benzimidazole-4,1'-cyclopentane]-3-carbonitrile is N#CC1=C(N)Nc2nc3ccccc3n2C12CCCC2.
What is the InChIKey of 2-aminospiro[1H-pyrimido[1,2-a]benzimidazole-4,1'-cyclopentane]-3-carbonitrile?
The InChIKey is FJXYISIQQRDRBC-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H15N5/c16-9-10-13(17)19-14-18-11-5-1-2-6-12(11)20(14)15(10)7-3-4-8-15/h1-2,5-6H,3-4,7-8,17H2,(H,18,19).
What are the key properties of 2-aminospiro[1H-pyrimido[1,2-a]benzimidazole-4,1'-cyclopentane]-3-carbonitrile?
2-aminospiro[1H-pyrimido[1,2-a]benzimidazole-4,1'-cyclopentane]-3-carbonitrile has a molecular weight of 265.32 g/mol, XLogP of 2.42, 0 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-aminospiro[1H-pyrimido[1,2-a]benzimidazole-4,1'-cyclopentane]-3-carbonitrile is sourced from PubChem (CID 137147616), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).