C18H16N2O3 — CID 137147798
7-[2-(2-methoxyphenyl)ethylideneamino]quinoline-5,8-diol (PubChem CID 137147798) has the molecular formula C18H16N2O3 and a molecular weight of 308.34 g/mol. Its IUPAC name is 7-[2-(2-methoxyphenyl)ethylideneamino]quinoline-5,8-diol.
| Compound Name | 7-[2-(2-methoxyphenyl)ethylideneamino]quinoline-5,8-diol |
|---|---|
| PubChem CID | 137147798 |
| Molecular Formula | C18H16N2O3 |
| Molecular Weight | 308.34 g/mol |
| Exact Mass | 308.12 |
| IUPAC Name | 7-[2-(2-methoxyphenyl)ethylideneamino]quinoline-5,8-diol |
| SMILES | COc1ccccc1C/C=N/c1cc(O)c2cccnc2c1O |
| InChI | InChI=1S/C18H16N2O3/c1-23-16-7-3-2-5-12(16)8-10-19-14-11-15(21)13-6-4-9-20-17(13)18(14)22/h2-7,9-11,21-22H,8H2,1H3/b19-10+ |
| InChIKey | MTJZXASOPWXLNC-VXLYETTFSA-N |
| XLogP | 3.60 |
| TPSA | 74.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.34 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_phenol_A(3)', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|