C10H17N5O — CID 137148918
2-amino-6-butan-2-yl-5,6,7,8-tetrahydro-3H-pteridin-4-one (PubChem CID 137148918) has the molecular formula C10H17N5O and a molecular weight of 223.28 g/mol. Its IUPAC name is 2-amino-6-butan-2-yl-5,6,7,8-tetrahydro-3H-pteridin-4-one.
| Compound Name | 2-amino-6-butan-2-yl-5,6,7,8-tetrahydro-3H-pteridin-4-one |
|---|---|
| PubChem CID | 137148918 |
| Molecular Formula | C10H17N5O |
| Molecular Weight | 223.28 g/mol |
| Exact Mass | 223.14 |
| IUPAC Name | 2-amino-6-butan-2-yl-5,6,7,8-tetrahydro-3H-pteridin-4-one |
| SMILES | CCC(C)C1CNc2nc(N)[nH]c(=O)c2N1 |
| InChI | InChI=1S/C10H17N5O/c1-3-5(2)6-4-12-8-7(13-6)9(16)15-10(11)14-8/h5-6,13H,3-4H2,1-2H3,(H4,11,12,14,15,16) |
| InChIKey | CIZUOKVFOUQFMM-UHFFFAOYSA-N |
| XLogP | 0.60 |
| TPSA | 95.83 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.28 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |