C20H22N9O11P — CID 137149240
2-amino-9-[(14R)-5,11,16-trihydroxy-11-oxo-6-(4-oxo-3H-pyrazolo[1,5-a][1,3,5]triazin-8-yl)-3,7,10,12,15-pentaoxa-11λ5-phosphatricyclo[11.2.1.04,8]hexadecan-14-yl]-1H-purin-6-one (PubChem CID 137149240) has the molecular formula C20H22N9O11P and a molecular weight of 595.42 g/mol. Its IUPAC name is 2-amino-9-[(14R)-5,11,16-trihydroxy-11-oxo-6-(4-oxo-3H-pyrazolo[1,5-a][1,3,5]triazin-8-yl)-3,7,10,12,15-pentaoxa-11λ5-phosphatricyclo[11.2.1.04,8]hexadecan-14-yl]-1H-purin-6-one.
| Compound Name | 2-amino-9-[(14R)-5,11,16-trihydroxy-11-oxo-6-(4-oxo-3H-pyrazolo[1,5-a][1,3,5]triazin-8-yl)-3,7,10,12,15-pentaoxa-11λ5-phosphatricyclo[11.2.1.04,8]hexadecan-14-yl]-1H-purin-6-one |
|---|---|
| PubChem CID | 137149240 |
| Molecular Formula | C20H22N9O11P |
| Molecular Weight | 595.42 g/mol |
| Exact Mass | 595.12 |
| IUPAC Name | 2-amino-9-[(14R)-5,11,16-trihydroxy-11-oxo-6-(4-oxo-3H-pyrazolo[1,5-a][1,3,5]triazin-8-yl)-3,7,10,12,15-pentaoxa-11λ5-phosphatricyclo[11.2.1.04,8]hexadecan-14-yl]-1H-purin-6-one |
| SMILES | Nc1nc2c(ncn2[C@@H]2OC3COC4C(COP(=O)(O)OC2C3O)OC(c2cnn3c(=O)[nH]cnc23)C4O)c(=O)[nH]1 |
| InChI | InChI=1S/C20H22N9O11P/c21-19-26-16-9(17(32)27-19)24-5-28(16)18-14-10(30)7(39-18)2-36-13-8(3-37-41(34,35)40-14)38-12(11(13)31)6-1-25-29-15(6)22-4-23-20(29)33/h1,4-5,7-8,10-14,18,30-31H,2-3H2,(H,34,35)(H,22,23,33)(H3,21,26,27,32)/t7?,8?,10?,11?,12?,13?,14?,18-/m1/s1 |
| InChIKey | GSCGDMGHPNZCQG-LQCBAALCSA-N |
| XLogP | -2.91 |
| TPSA | 276.55 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 17 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 41 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 595.42 |
| LogP ≤ 5 | -2.91 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 17 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|