C15H17F3N2O4S — CID 137150579
2-methylimino-5-(2,2,2-trifluoro-1-phenoxyethyl)-1,3a,5,6,7,7a-hexahydropyrano[3,2-d][1,3]thiazole-6,7-diol (PubChem CID 137150579) has the molecular formula C15H17F3N2O4S and a molecular weight of 378.37 g/mol. Its IUPAC name is 2-methylimino-5-(2,2,2-trifluoro-1-phenoxyethyl)-1,3a,5,6,7,7a-hexahydropyrano[3,2-d][1,3]thiazole-6,7-diol.
| Compound Name | 2-methylimino-5-(2,2,2-trifluoro-1-phenoxyethyl)-1,3a,5,6,7,7a-hexahydropyrano[3,2-d][1,3]thiazole-6,7-diol |
|---|---|
| PubChem CID | 137150579 |
| Molecular Formula | C15H17F3N2O4S |
| Molecular Weight | 378.37 g/mol |
| Exact Mass | 378.09 |
| IUPAC Name | 2-methylimino-5-(2,2,2-trifluoro-1-phenoxyethyl)-1,3a,5,6,7,7a-hexahydropyrano[3,2-d][1,3]thiazole-6,7-diol |
| SMILES | C/N=C1/NC2C(OC(C(Oc3ccccc3)C(F)(F)F)C(O)C2O)S1 |
| InChI | InChI=1S/C15H17F3N2O4S/c1-19-14-20-8-9(21)10(22)11(24-13(8)25-14)12(15(16,17)18)23-7-5-3-2-4-6-7/h2-6,8-13,21-22H,1H3,(H,19,20) |
| InChIKey | XZLBZKHLKVSWGY-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 83.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.37 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|