C24H19F6N3O2S — CID 137150680
(5Z)-5-[[1-[[2,4-bis(trifluoromethyl)phenyl]methyl]-3,3-dimethyl-2-oxoindol-4-yl]methylidene]-4-methylimino-1,3-thiazolidin-2-one (PubChem CID 137150680) has the molecular formula C24H19F6N3O2S and a molecular weight of 527.49 g/mol. Its IUPAC name is (5Z)-5-[[1-[[2,4-bis(trifluoromethyl)phenyl]methyl]-3,3-dimethyl-2-oxoindol-4-yl]methylidene]-4-methylimino-1,3-thiazolidin-2-one.
| Compound Name | (5Z)-5-[[1-[[2,4-bis(trifluoromethyl)phenyl]methyl]-3,3-dimethyl-2-oxoindol-4-yl]methylidene]-4-methylimino-1,3-thiazolidin-2-one |
|---|---|
| PubChem CID | 137150680 |
| Molecular Formula | C24H19F6N3O2S |
| Molecular Weight | 527.49 g/mol |
| Exact Mass | 527.11 |
| IUPAC Name | (5Z)-5-[[1-[[2,4-bis(trifluoromethyl)phenyl]methyl]-3,3-dimethyl-2-oxoindol-4-yl]methylidene]-4-methylimino-1,3-thiazolidin-2-one |
| SMILES | C/N=C1\NC(=O)S\C1=C/c1cccc2c1C(C)(C)C(=O)N2Cc1ccc(C(F)(F)F)cc1C(F)(F)F |
| InChI | InChI=1S/C24H19F6N3O2S/c1-22(2)18-12(9-17-19(31-3)32-21(35)36-17)5-4-6-16(18)33(20(22)34)11-13-7-8-14(23(25,26)27)10-15(13)24(28,29)30/h4-10H,11H2,1-3H3,(H,31,32,35)/b17-9- |
| InChIKey | SPJHEGGBVUYYEN-MFOYZWKCSA-N |
| XLogP | 6.37 |
| TPSA | 61.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.49 |
| LogP ≤ 5 | 6.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|