C21H12FN3O2S — CID 137150798
4-[5-[(Z)-[2-(4-fluorophenyl)imino-4-oxo-1,3-thiazolidin-5-ylidene]methyl]furan-2-yl]benzonitrile (PubChem CID 137150798) has the molecular formula C21H12FN3O2S and a molecular weight of 389.41 g/mol. Its IUPAC name is 4-[5-[(Z)-[2-(4-fluorophenyl)imino-4-oxo-1,3-thiazolidin-5-ylidene]methyl]furan-2-yl]benzonitrile.
| Compound Name | 4-[5-[(Z)-[2-(4-fluorophenyl)imino-4-oxo-1,3-thiazolidin-5-ylidene]methyl]furan-2-yl]benzonitrile |
|---|---|
| PubChem CID | 137150798 |
| Molecular Formula | C21H12FN3O2S |
| Molecular Weight | 389.41 g/mol |
| Exact Mass | 389.06 |
| IUPAC Name | 4-[5-[(Z)-[2-(4-fluorophenyl)imino-4-oxo-1,3-thiazolidin-5-ylidene]methyl]furan-2-yl]benzonitrile |
| SMILES | N#Cc1ccc(-c2ccc(/C=C3\S/C(=N/c4ccc(F)cc4)NC3=O)o2)cc1 |
| InChI | InChI=1S/C21H12FN3O2S/c22-15-5-7-16(8-6-15)24-21-25-20(26)19(28-21)11-17-9-10-18(27-17)14-3-1-13(12-23)2-4-14/h1-11H,(H,24,25,26)/b19-11- |
| InChIKey | ULWASLAGJCROIB-ODLFYWEKSA-N |
| XLogP | 4.85 |
| TPSA | 78.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.41 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_rhod_C(13)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|