C17H19F7N6S — CID 137151634
6-(3,3-difluorocyclopentyl)-2-(3,3-difluorocyclopentyl)imino-6-[4-(trifluoromethyl)-1,3-thiazol-2-yl]-1,3-dihydro-1,3,5-triazin-4-amine (PubChem CID 137151634) has the molecular formula C17H19F7N6S and a molecular weight of 472.43 g/mol. Its IUPAC name is 6-(3,3-difluorocyclopentyl)-2-(3,3-difluorocyclopentyl)imino-6-[4-(trifluoromethyl)-1,3-thiazol-2-yl]-1,3-dihydro-1,3,5-triazin-4-amine.
| Compound Name | 6-(3,3-difluorocyclopentyl)-2-(3,3-difluorocyclopentyl)imino-6-[4-(trifluoromethyl)-1,3-thiazol-2-yl]-1,3-dihydro-1,3,5-triazin-4-amine |
|---|---|
| PubChem CID | 137151634 |
| Molecular Formula | C17H19F7N6S |
| Molecular Weight | 472.43 g/mol |
| Exact Mass | 472.13 |
| IUPAC Name | 6-(3,3-difluorocyclopentyl)-2-(3,3-difluorocyclopentyl)imino-6-[4-(trifluoromethyl)-1,3-thiazol-2-yl]-1,3-dihydro-1,3,5-triazin-4-amine |
| SMILES | NC1=NC(c2nc(C(F)(F)F)cs2)(C2CCC(F)(F)C2)N/C(=N/C2CCC(F)(F)C2)N1 |
| InChI | InChI=1S/C17H19F7N6S/c18-14(19)3-1-8(5-14)16(11-27-10(7-31-11)17(22,23)24)29-12(25)28-13(30-16)26-9-2-4-15(20,21)6-9/h7-9H,1-6H2,(H4,25,26,28,29,30) |
| InChIKey | OCEFOQVQLKSBPA-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 87.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.43 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|