C18H20F7N7 — CID 137151638
6-(3,3-difluorocyclopentyl)-2-(3,3-difluorocyclopentyl)imino-6-[6-(trifluoromethyl)pyrazin-2-yl]-1,3-dihydro-1,3,5-triazin-4-amine (PubChem CID 137151638) has the molecular formula C18H20F7N7 and a molecular weight of 467.39 g/mol. Its IUPAC name is 6-(3,3-difluorocyclopentyl)-2-(3,3-difluorocyclopentyl)imino-6-[6-(trifluoromethyl)pyrazin-2-yl]-1,3-dihydro-1,3,5-triazin-4-amine.
| Compound Name | 6-(3,3-difluorocyclopentyl)-2-(3,3-difluorocyclopentyl)imino-6-[6-(trifluoromethyl)pyrazin-2-yl]-1,3-dihydro-1,3,5-triazin-4-amine |
|---|---|
| PubChem CID | 137151638 |
| Molecular Formula | C18H20F7N7 |
| Molecular Weight | 467.39 g/mol |
| Exact Mass | 467.17 |
| IUPAC Name | 6-(3,3-difluorocyclopentyl)-2-(3,3-difluorocyclopentyl)imino-6-[6-(trifluoromethyl)pyrazin-2-yl]-1,3-dihydro-1,3,5-triazin-4-amine |
| SMILES | NC1=NC(c2cncc(C(F)(F)F)n2)(C2CCC(F)(F)C2)N/C(=N/C2CCC(F)(F)C2)N1 |
| InChI | InChI=1S/C18H20F7N7/c19-15(20)3-1-9(5-15)17(11-7-27-8-12(29-11)18(23,24)25)31-13(26)30-14(32-17)28-10-2-4-16(21,22)6-10/h7-10H,1-6H2,(H4,26,28,30,31,32) |
| InChIKey | BOKBPEDXGQGCKD-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 100.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.39 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|