C17H17F7N6O — CID 137151668
6-(3,3-difluorocyclobutyl)-2-(3,3-difluorocyclobutyl)imino-6-[6-(trifluoromethoxy)-2-pyridinyl]-1,3-dihydro-1,3,5-triazin-4-amine (PubChem CID 137151668) has the molecular formula C17H17F7N6O and a molecular weight of 454.35 g/mol. Its IUPAC name is 6-(3,3-difluorocyclobutyl)-2-(3,3-difluorocyclobutyl)imino-6-[6-(trifluoromethoxy)-2-pyridinyl]-1,3-dihydro-1,3,5-triazin-4-amine.
| Compound Name | 6-(3,3-difluorocyclobutyl)-2-(3,3-difluorocyclobutyl)imino-6-[6-(trifluoromethoxy)-2-pyridinyl]-1,3-dihydro-1,3,5-triazin-4-amine |
|---|---|
| PubChem CID | 137151668 |
| Molecular Formula | C17H17F7N6O |
| Molecular Weight | 454.35 g/mol |
| Exact Mass | 454.14 |
| IUPAC Name | 6-(3,3-difluorocyclobutyl)-2-(3,3-difluorocyclobutyl)imino-6-[6-(trifluoromethoxy)-2-pyridinyl]-1,3-dihydro-1,3,5-triazin-4-amine |
| SMILES | NC1=NC(c2cccc(OC(F)(F)F)n2)(C2CC(F)(F)C2)N/C(=N/C2CC(F)(F)C2)N1 |
| InChI | InChI=1S/C17H17F7N6O/c18-14(19)4-8(5-14)16(10-2-1-3-11(27-10)31-17(22,23)24)29-12(25)28-13(30-16)26-9-6-15(20,21)7-9/h1-3,8-9H,4-7H2,(H4,25,26,28,29,30) |
| InChIKey | MSTUQLRWVORZKZ-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 96.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.35 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|