C10H12N2OS2 — CID 137152723
[(E)-1-(2-hydroxy-5-methylphenyl)ethylideneamino]carbamodithioic acid (PubChem CID 137152723) has the molecular formula C10H12N2OS2 and a molecular weight of 240.35 g/mol. Its IUPAC name is [(E)-1-(2-hydroxy-5-methylphenyl)ethylideneamino]carbamodithioic acid.
| Compound Name | [(E)-1-(2-hydroxy-5-methylphenyl)ethylideneamino]carbamodithioic acid |
|---|---|
| PubChem CID | 137152723 |
| Molecular Formula | C10H12N2OS2 |
| Molecular Weight | 240.35 g/mol |
| Exact Mass | 240.04 |
| IUPAC Name | [(E)-1-(2-hydroxy-5-methylphenyl)ethylideneamino]carbamodithioic acid |
| SMILES | C/C(=N\NC(=S)S)c1cc(C)ccc1O |
| InChI | InChI=1S/C10H12N2OS2/c1-6-3-4-9(13)8(5-6)7(2)11-12-10(14)15/h3-5,13H,1-2H3,(H2,12,14,15)/b11-7+ |
| InChIKey | HHPKSGIHRCRSBB-YRNVUSSQSA-N |
| XLogP | 2.23 |
| TPSA | 44.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.35 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|