C23H23IN2S — CID 137152781
2-[(E)-(1-ethyl-6-methylquinolin-2-ylidene)methyl]-3-methyl-4-phenyl-1,3-thiazol-3-ium iodide (PubChem CID 137152781) has the molecular formula C23H23IN2S and a molecular weight of 486.42 g/mol. Its IUPAC name is 2-[(E)-(1-ethyl-6-methylquinolin-2-ylidene)methyl]-3-methyl-4-phenyl-1,3-thiazol-3-ium iodide.
| Compound Name | 2-[(E)-(1-ethyl-6-methylquinolin-2-ylidene)methyl]-3-methyl-4-phenyl-1,3-thiazol-3-ium iodide |
|---|---|
| PubChem CID | 137152781 |
| Molecular Formula | C23H23IN2S |
| Molecular Weight | 486.42 g/mol |
| Exact Mass | 486.06 |
| IUPAC Name | 2-[(E)-(1-ethyl-6-methylquinolin-2-ylidene)methyl]-3-methyl-4-phenyl-1,3-thiazol-3-ium iodide |
| SMILES | CCN1/C(=C/c2scc(-c3ccccc3)[n+]2C)C=Cc2cc(C)ccc21.[I-] |
| InChI | InChI=1S/C23H23N2S.HI/c1-4-25-20(12-11-19-14-17(2)10-13-21(19)25)15-23-24(3)22(16-26-23)18-8-6-5-7-9-18;/h5-16H,4H2,1-3H3;1H/q+1;/p-1 |
| InChIKey | OFDAYOFHPVXJEN-UHFFFAOYSA-M |
| XLogP | 2.45 |
| TPSA | 7.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.42 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'dyes3A(19)', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|