C22H22FN9O — CID 137152873
12-cyano-21-fluoro-N',11,18-trimethyl-14-methylidene-17-oxa-2,3,8,10,11,15-hexazatetracyclo[17.4.0.02,7.09,13]tricosa-1(19),3,5,9,12,15,20,22-octaene-16-carboximidamide (PubChem CID 137152873) has the molecular formula C22H22FN9O and a molecular weight of 447.48 g/mol. Its IUPAC name is 12-cyano-21-fluoro-N',11,18-trimethyl-14-methylidene-17-oxa-2,3,8,10,11,15-hexazatetracyclo[17.4.0.02,7.09,13]tricosa-1(19),3,5,9,12,15,20,22-octaene-16-carboximidamide.
| Compound Name | 12-cyano-21-fluoro-N',11,18-trimethyl-14-methylidene-17-oxa-2,3,8,10,11,15-hexazatetracyclo[17.4.0.02,7.09,13]tricosa-1(19),3,5,9,12,15,20,22-octaene-16-carboximidamide |
|---|---|
| PubChem CID | 137152873 |
| Molecular Formula | C22H22FN9O |
| Molecular Weight | 447.48 g/mol |
| Exact Mass | 447.19 |
| IUPAC Name | 12-cyano-21-fluoro-N',11,18-trimethyl-14-methylidene-17-oxa-2,3,8,10,11,15-hexazatetracyclo[17.4.0.02,7.09,13]tricosa-1(19),3,5,9,12,15,20,22-octaene-16-carboximidamide |
| SMILES | C=C1/N=C(C(/N)=N/C)\OC(C)c2cc(F)ccc2N2N=CC=CC2Nc2nn(C)c(C#N)c21 |
| InChI | InChI=1S/C22H22FN9O/c1-12-19-17(11-24)31(4)30-21(19)29-18-6-5-9-27-32(18)16-8-7-14(23)10-15(16)13(2)33-22(28-12)20(25)26-3/h5-10,13,18H,1H2,2-4H3,(H2,25,26)(H,29,30)/b28-22- |
| InChIKey | GKJLKLCJUAMSQZ-SLMZUGIISA-N |
| XLogP | 2.68 |
| TPSA | 129.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.48 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|