C20H23F3N4O — CID 137152937
4-(cyclohexylamino)-2-oxo-N'-[4-(2,2,2-trifluoroethyl)phenyl]-1H-pyridine-3-carboximidamide (PubChem CID 137152937) has the molecular formula C20H23F3N4O and a molecular weight of 392.43 g/mol. Its IUPAC name is 4-(cyclohexylamino)-2-oxo-N'-[4-(2,2,2-trifluoroethyl)phenyl]-1H-pyridine-3-carboximidamide.
| Compound Name | 4-(cyclohexylamino)-2-oxo-N'-[4-(2,2,2-trifluoroethyl)phenyl]-1H-pyridine-3-carboximidamide |
|---|---|
| PubChem CID | 137152937 |
| Molecular Formula | C20H23F3N4O |
| Molecular Weight | 392.43 g/mol |
| Exact Mass | 392.18 |
| IUPAC Name | 4-(cyclohexylamino)-2-oxo-N'-[4-(2,2,2-trifluoroethyl)phenyl]-1H-pyridine-3-carboximidamide |
| SMILES | N/C(=N\c1ccc(CC(F)(F)F)cc1)c1c(NC2CCCCC2)cc[nH]c1=O |
| InChI | InChI=1S/C20H23F3N4O/c21-20(22,23)12-13-6-8-15(9-7-13)27-18(24)17-16(10-11-25-19(17)28)26-14-4-2-1-3-5-14/h6-11,14H,1-5,12H2,(H2,24,27)(H2,25,26,28) |
| InChIKey | GUCVMZWCCKNKRW-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 83.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.43 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|