C8H5F3N4OS — CID 137153115
4-[3-(trifluoromethylsulfanyl)phenyl]-1H-tetrazol-5-one (PubChem CID 137153115) has the molecular formula C8H5F3N4OS and a molecular weight of 262.22 g/mol. Its IUPAC name is 4-[3-(trifluoromethylsulfanyl)phenyl]-1H-tetrazol-5-one.
| Compound Name | 4-[3-(trifluoromethylsulfanyl)phenyl]-1H-tetrazol-5-one |
|---|---|
| PubChem CID | 137153115 |
| Molecular Formula | C8H5F3N4OS |
| Molecular Weight | 262.22 g/mol |
| Exact Mass | 262.01 |
| IUPAC Name | 4-[3-(trifluoromethylsulfanyl)phenyl]-1H-tetrazol-5-one |
| SMILES | O=c1[nH]nnn1-c1cccc(SC(F)(F)F)c1 |
| InChI | InChI=1S/C8H5F3N4OS/c9-8(10,11)17-6-3-1-2-5(4-6)15-7(16)12-13-14-15/h1-4H,(H,12,14,16) |
| InChIKey | WXFSKKIOLTUFAY-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 63.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.22 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |