C27H29N3O2 — CID 137153554
2-[[[(2S)-6-ethenyl-1-azabicyclo[2.2.2]octan-2-yl]-(6-methoxyquinolin-4-yl)methyl]iminomethyl]phenol (PubChem CID 137153554) has the molecular formula C27H29N3O2 and a molecular weight of 427.55 g/mol. Its IUPAC name is 2-[[[(2S)-6-ethenyl-1-azabicyclo[2.2.2]octan-2-yl]-(6-methoxyquinolin-4-yl)methyl]iminomethyl]phenol.
| Compound Name | 2-[[[(2S)-6-ethenyl-1-azabicyclo[2.2.2]octan-2-yl]-(6-methoxyquinolin-4-yl)methyl]iminomethyl]phenol |
|---|---|
| PubChem CID | 137153554 |
| Molecular Formula | C27H29N3O2 |
| Molecular Weight | 427.55 g/mol |
| Exact Mass | 427.23 |
| IUPAC Name | 2-[[[(2S)-6-ethenyl-1-azabicyclo[2.2.2]octan-2-yl]-(6-methoxyquinolin-4-yl)methyl]iminomethyl]phenol |
| SMILES | C=CC1CC2CCN1[C@H](C(/N=C/c1ccccc1O)c1ccnc3ccc(OC)cc13)C2 |
| InChI | InChI=1S/C27H29N3O2/c1-3-20-14-18-11-13-30(20)25(15-18)27(29-17-19-6-4-5-7-26(19)31)22-10-12-28-24-9-8-21(32-2)16-23(22)24/h3-10,12,16-18,20,25,27,31H,1,11,13-15H2,2H3/b29-17+/t18?,20?,25-,27?/m0/s1 |
| InChIKey | KTJRZCCFMGZTIZ-GBOZSPSRSA-N |
| XLogP | 5.15 |
| TPSA | 57.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.55 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|