C10H17FN2S — CID 137153620
N-(2-fluoroethyl)-1,4,4a,5,6,7,8,8a-octahydrobenzo[d][1,3]thiazin-2-imine (PubChem CID 137153620) has the molecular formula C10H17FN2S and a molecular weight of 216.32 g/mol. Its IUPAC name is N-(2-fluoroethyl)-1,4,4a,5,6,7,8,8a-octahydrobenzo[d][1,3]thiazin-2-imine.
| Compound Name | N-(2-fluoroethyl)-1,4,4a,5,6,7,8,8a-octahydrobenzo[d][1,3]thiazin-2-imine |
|---|---|
| PubChem CID | 137153620 |
| Molecular Formula | C10H17FN2S |
| Molecular Weight | 216.32 g/mol |
| Exact Mass | 216.11 |
| IUPAC Name | N-(2-fluoroethyl)-1,4,4a,5,6,7,8,8a-octahydrobenzo[d][1,3]thiazin-2-imine |
| SMILES | FCC/N=C1/NC2CCCCC2CS1 |
| InChI | InChI=1S/C10H17FN2S/c11-5-6-12-10-13-9-4-2-1-3-8(9)7-14-10/h8-9H,1-7H2,(H,12,13) |
| InChIKey | VYNOQOPKFTUGSA-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.32 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|