About 2-(chloromethyl)-5-(1H-indol-2-yl)-1,3,4-oxadiazole
2-(chloromethyl)-5-(1H-indol-2-yl)-1,3,4-oxadiazole (PubChem CID 137153670) has the molecular formula C11H8ClN3O
and a molecular weight of 233.66 g/mol. Its IUPAC name is 2-(chloromethyl)-5-(1H-indol-2-yl)-1,3,4-oxadiazole.
Molecular Properties
| Compound Name | 2-(chloromethyl)-5-(1H-indol-2-yl)-1,3,4-oxadiazole |
| PubChem CID | 137153670 |
| Molecular Formula | C11H8ClN3O |
| Molecular Weight | 233.66 g/mol |
| Exact Mass | 233.04 |
| IUPAC Name | 2-(chloromethyl)-5-(1H-indol-2-yl)-1,3,4-oxadiazole |
| SMILES | ClCc1nnc(-c2cc3ccccc3[nH]2)o1 |
| InChI | InChI=1S/C11H8ClN3O/c12-6-10-14-15-11(16-10)9-5-7-3-1-2-4-8(7)13-9/h1-5,13H,6H2 |
| InChIKey | RGBJSMXYAWKTCC-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 54.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 233.66 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 2-(chloromethyl)-5-(1H-indol-2-yl)-1,3,4-oxadiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(chloromethyl)-5-(1H-indol-2-yl)-1,3,4-oxadiazole?
The IUPAC name of 2-(chloromethyl)-5-(1H-indol-2-yl)-1,3,4-oxadiazole (CID 137153670) is 2-(chloromethyl)-5-(1H-indol-2-yl)-1,3,4-oxadiazole.
What is the SMILES notation for 2-(chloromethyl)-5-(1H-indol-2-yl)-1,3,4-oxadiazole?
The canonical SMILES for 2-(chloromethyl)-5-(1H-indol-2-yl)-1,3,4-oxadiazole is ClCc1nnc(-c2cc3ccccc3[nH]2)o1.
What is the InChIKey of 2-(chloromethyl)-5-(1H-indol-2-yl)-1,3,4-oxadiazole?
The InChIKey is RGBJSMXYAWKTCC-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H8ClN3O/c12-6-10-14-15-11(16-10)9-5-7-3-1-2-4-8(7)13-9/h1-5,13H,6H2.
What are the key properties of 2-(chloromethyl)-5-(1H-indol-2-yl)-1,3,4-oxadiazole?
2-(chloromethyl)-5-(1H-indol-2-yl)-1,3,4-oxadiazole has a molecular weight of 233.66 g/mol, XLogP of 2.96, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(chloromethyl)-5-(1H-indol-2-yl)-1,3,4-oxadiazole is sourced from PubChem (CID 137153670), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).