C11H14N2O5 — CID 137153698
diethyl 5-methyl-6-oxo-1H-pyrimidine-2,4-dicarboxylate (PubChem CID 137153698) has the molecular formula C11H14N2O5 and a molecular weight of 254.24 g/mol. Its IUPAC name is diethyl 5-methyl-6-oxo-1H-pyrimidine-2,4-dicarboxylate.
| Compound Name | diethyl 5-methyl-6-oxo-1H-pyrimidine-2,4-dicarboxylate |
|---|---|
| PubChem CID | 137153698 |
| Molecular Formula | C11H14N2O5 |
| Molecular Weight | 254.24 g/mol |
| Exact Mass | 254.09 |
| IUPAC Name | diethyl 5-methyl-6-oxo-1H-pyrimidine-2,4-dicarboxylate |
| SMILES | CCOC(=O)c1nc(C(=O)OCC)c(C)c(=O)[nH]1 |
| InChI | InChI=1S/C11H14N2O5/c1-4-17-10(15)7-6(3)9(14)13-8(12-7)11(16)18-5-2/h4-5H2,1-3H3,(H,12,13,14) |
| InChIKey | VUJGJDXOIPEGFP-UHFFFAOYSA-N |
| XLogP | 0.43 |
| TPSA | 98.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.24 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |