C10H7N3O — CID 137154311
(4aR)-4a,5-dihydropyrimido[5,4-b]indol-4-one (PubChem CID 137154311) has the molecular formula C10H7N3O and a molecular weight of 185.19 g/mol. Its IUPAC name is (4aR)-4a,5-dihydropyrimido[5,4-b]indol-4-one.
| Compound Name | (4aR)-4a,5-dihydropyrimido[5,4-b]indol-4-one |
|---|---|
| PubChem CID | 137154311 |
| Molecular Formula | C10H7N3O |
| Molecular Weight | 185.19 g/mol |
| Exact Mass | 185.06 |
| IUPAC Name | (4aR)-4a,5-dihydropyrimido[5,4-b]indol-4-one |
| SMILES | O=C1N=CN=C2c3ccccc3N[C@@H]12 |
| InChI | InChI=1S/C10H7N3O/c14-10-9-8(11-5-12-10)6-3-1-2-4-7(6)13-9/h1-5,9,13H/t9-/m1/s1 |
| InChIKey | FYXIDBCUEMZCDM-SECBINFHSA-N |
| XLogP | 0.84 |
| TPSA | 53.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 185.19 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |