About (4aR)-4a,5-dihydropyrimido[5,4-b]indol-4-one
(4aR)-4a,5-dihydropyrimido[5,4-b]indol-4-one (PubChem CID 137154311) has the molecular formula C10H7N3O
and a molecular weight of 185.19 g/mol. Its IUPAC name is (4aR)-4a,5-dihydropyrimido[5,4-b]indol-4-one.
Molecular Properties
| Compound Name | (4aR)-4a,5-dihydropyrimido[5,4-b]indol-4-one |
| PubChem CID | 137154311 |
| Molecular Formula | C10H7N3O |
| Molecular Weight | 185.19 g/mol |
| Exact Mass | 185.06 |
| IUPAC Name | (4aR)-4a,5-dihydropyrimido[5,4-b]indol-4-one |
| SMILES | O=C1N=CN=C2c3ccccc3N[C@@H]12 |
| InChI | InChI=1S/C10H7N3O/c14-10-9-8(11-5-12-10)6-3-1-2-4-7(6)13-9/h1-5,9,13H/t9-/m1/s1 |
| InChIKey | FYXIDBCUEMZCDM-SECBINFHSA-N |
| XLogP | 0.84 |
| TPSA | 53.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 185.19 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (4aR)-4a,5-dihydropyrimido[5,4-b]indol-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4aR)-4a,5-dihydropyrimido[5,4-b]indol-4-one?
The IUPAC name of (4aR)-4a,5-dihydropyrimido[5,4-b]indol-4-one (CID 137154311) is (4aR)-4a,5-dihydropyrimido[5,4-b]indol-4-one.
What is the SMILES notation for (4aR)-4a,5-dihydropyrimido[5,4-b]indol-4-one?
The canonical SMILES for (4aR)-4a,5-dihydropyrimido[5,4-b]indol-4-one is O=C1N=CN=C2c3ccccc3N[C@@H]12.
What is the InChIKey of (4aR)-4a,5-dihydropyrimido[5,4-b]indol-4-one?
The InChIKey is FYXIDBCUEMZCDM-SECBINFHSA-N. The full InChI is InChI=1S/C10H7N3O/c14-10-9-8(11-5-12-10)6-3-1-2-4-7(6)13-9/h1-5,9,13H/t9-/m1/s1.
What are the key properties of (4aR)-4a,5-dihydropyrimido[5,4-b]indol-4-one?
(4aR)-4a,5-dihydropyrimido[5,4-b]indol-4-one has a molecular weight of 185.19 g/mol, XLogP of 0.84, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (4aR)-4a,5-dihydropyrimido[5,4-b]indol-4-one is sourced from PubChem (CID 137154311), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).