C17H25ClN4O — CID 137154638
2-[[ethyl(piperidin-3-ylmethyl)amino]methyl]-3H-quinazolin-4-one;hydrochloride (PubChem CID 137154638) has the molecular formula C17H25ClN4O and a molecular weight of 336.87 g/mol. Its IUPAC name is 2-[[ethyl(piperidin-3-ylmethyl)amino]methyl]-3H-quinazolin-4-one;hydrochloride.
| Compound Name | 2-[[ethyl(piperidin-3-ylmethyl)amino]methyl]-3H-quinazolin-4-one;hydrochloride |
|---|---|
| PubChem CID | 137154638 |
| Molecular Formula | C17H25ClN4O |
| Molecular Weight | 336.87 g/mol |
| Exact Mass | 336.17 |
| IUPAC Name | 2-[[ethyl(piperidin-3-ylmethyl)amino]methyl]-3H-quinazolin-4-one;hydrochloride |
| SMILES | CCN(Cc1nc2ccccc2c(=O)[nH]1)CC1CCCNC1.Cl |
| InChI | InChI=1S/C17H24N4O.ClH/c1-2-21(11-13-6-5-9-18-10-13)12-16-19-15-8-4-3-7-14(15)17(22)20-16;/h3-4,7-8,13,18H,2,5-6,9-12H2,1H3,(H,19,20,22);1H |
| InChIKey | OKYHQPGRNFJEGE-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 61.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.87 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |