C26H28N4+2 — CID 137154952
4,11-bis(2,4,6-trimethylphenyl)-1,2-diaza-4,11-diazoniatricyclo[7.3.0.02,6]dodeca-3,5,7,9,11-pentaene (PubChem CID 137154952) has the molecular formula C26H28N4+2 and a molecular weight of 396.54 g/mol. Its IUPAC name is 4,11-bis(2,4,6-trimethylphenyl)-1,2-diaza-4,11-diazoniatricyclo[7.3.0.02,6]dodeca-3,5,7,9,11-pentaene.
| Compound Name | 4,11-bis(2,4,6-trimethylphenyl)-1,2-diaza-4,11-diazoniatricyclo[7.3.0.02,6]dodeca-3,5,7,9,11-pentaene |
|---|---|
| PubChem CID | 137154952 |
| Molecular Formula | C26H28N4+2 |
| Molecular Weight | 396.54 g/mol |
| Exact Mass | 396.23 |
| IUPAC Name | 4,11-bis(2,4,6-trimethylphenyl)-1,2-diaza-4,11-diazoniatricyclo[7.3.0.02,6]dodeca-3,5,7,9,11-pentaene |
| SMILES | Cc1cc(C)c(-[n+]2cc3ccc4c[n+](-c5c(C)cc(C)cc5C)cn4n3c2)c(C)c1 |
| InChI | InChI=1S/C26H28N4/c1-17-9-19(3)25(20(4)10-17)27-13-23-7-8-24-14-28(16-30(24)29(23)15-27)26-21(5)11-18(2)12-22(26)6/h7-16H,1-6H3/q+2 |
| InChIKey | ZXSMWVHKAVYARI-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 16.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.54 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|