C23H25FN6OS — CID 137155013
1-[2-(2-fluorophenyl)pyrrolidin-1-yl]-3-[5-(2-morpholin-4-yl-1,3-thiazol-4-yl)-1H-imidazol-2-yl]prop-2-en-1-imine (PubChem CID 137155013) has the molecular formula C23H25FN6OS and a molecular weight of 452.56 g/mol. Its IUPAC name is 1-[2-(2-fluorophenyl)pyrrolidin-1-yl]-3-[5-(2-morpholin-4-yl-1,3-thiazol-4-yl)-1H-imidazol-2-yl]prop-2-en-1-imine.
| Compound Name | 1-[2-(2-fluorophenyl)pyrrolidin-1-yl]-3-[5-(2-morpholin-4-yl-1,3-thiazol-4-yl)-1H-imidazol-2-yl]prop-2-en-1-imine |
|---|---|
| PubChem CID | 137155013 |
| Molecular Formula | C23H25FN6OS |
| Molecular Weight | 452.56 g/mol |
| Exact Mass | 452.18 |
| IUPAC Name | 1-[2-(2-fluorophenyl)pyrrolidin-1-yl]-3-[5-(2-morpholin-4-yl-1,3-thiazol-4-yl)-1H-imidazol-2-yl]prop-2-en-1-imine |
| SMILES | [H]/N=C(\C=Cc1ncc(-c2csc(N3CCOCC3)n2)[nH]1)N1CCCC1c1ccccc1F |
| InChI | InChI=1S/C23H25FN6OS/c24-17-5-2-1-4-16(17)20-6-3-9-30(20)21(25)7-8-22-26-14-18(27-22)19-15-32-23(28-19)29-10-12-31-13-11-29/h1-2,4-5,7-8,14-15,20,25H,3,6,9-13H2,(H,26,27)/b8-7?,25-21+ |
| InChIKey | OBIYGQLESWSJRR-ZGCJPTENSA-N |
| XLogP | 4.34 |
| TPSA | 81.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.56 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|