C26H25F3N4O4 — CID 137155506
(6S,9R)-9-(4-methylphenyl)-2-(trifluoromethyl)-6-(3,4,5-trimethoxyphenyl)-5,6,7,9-tetrahydro-4H-[1,2,4]triazolo[5,1-b]quinazolin-8-one (PubChem CID 137155506) has the molecular formula C26H25F3N4O4 and a molecular weight of 514.50 g/mol. Its IUPAC name is (6S,9R)-9-(4-methylphenyl)-2-(trifluoromethyl)-6-(3,4,5-trimethoxyphenyl)-5,6,7,9-tetrahydro-4H-[1,2,4]triazolo[5,1-b]quinazolin-8-one.
| Compound Name | (6S,9R)-9-(4-methylphenyl)-2-(trifluoromethyl)-6-(3,4,5-trimethoxyphenyl)-5,6,7,9-tetrahydro-4H-[1,2,4]triazolo[5,1-b]quinazolin-8-one |
|---|---|
| PubChem CID | 137155506 |
| Molecular Formula | C26H25F3N4O4 |
| Molecular Weight | 514.50 g/mol |
| Exact Mass | 514.18 |
| IUPAC Name | (6S,9R)-9-(4-methylphenyl)-2-(trifluoromethyl)-6-(3,4,5-trimethoxyphenyl)-5,6,7,9-tetrahydro-4H-[1,2,4]triazolo[5,1-b]quinazolin-8-one |
| SMILES | COc1cc([C@@H]2CC(=O)C3=C(C2)Nc2nc(C(F)(F)F)nn2[C@@H]3c2ccc(C)cc2)cc(OC)c1OC |
| InChI | InChI=1S/C26H25F3N4O4/c1-13-5-7-14(8-6-13)22-21-17(30-25-31-24(26(27,28)29)32-33(22)25)9-15(10-18(21)34)16-11-19(35-2)23(37-4)20(12-16)36-3/h5-8,11-12,15,22H,9-10H2,1-4H3,(H,30,31,32)/t15-,22+/m0/s1 |
| InChIKey | ROQKUZAZWRGZIE-OYHNWAKOSA-N |
| XLogP | 5.05 |
| TPSA | 87.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.50 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |