C25H26N4O5S2 — CID 137156535
4-[4-[[5-[[2-(cyclopropanecarbonylamino)-1,3-thiazol-5-yl]methylidene]-4-oxo-1,3-thiazolidin-2-ylidene]amino]-3-methylphenoxy]cyclohexane-1-carboxylic acid (PubChem CID 137156535) has the molecular formula C25H26N4O5S2 and a molecular weight of 526.64 g/mol. Its IUPAC name is 4-[4-[[5-[[2-(cyclopropanecarbonylamino)-1,3-thiazol-5-yl]methylidene]-4-oxo-1,3-thiazolidin-2-ylidene]amino]-3-methylphenoxy]cyclohexane-1-carboxylic acid.
| Compound Name | 4-[4-[[5-[[2-(cyclopropanecarbonylamino)-1,3-thiazol-5-yl]methylidene]-4-oxo-1,3-thiazolidin-2-ylidene]amino]-3-methylphenoxy]cyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 137156535 |
| Molecular Formula | C25H26N4O5S2 |
| Molecular Weight | 526.64 g/mol |
| Exact Mass | 526.13 |
| IUPAC Name | 4-[4-[[5-[[2-(cyclopropanecarbonylamino)-1,3-thiazol-5-yl]methylidene]-4-oxo-1,3-thiazolidin-2-ylidene]amino]-3-methylphenoxy]cyclohexane-1-carboxylic acid |
| SMILES | Cc1cc(OC2CCC(C(=O)O)CC2)ccc1/N=C1/NC(=O)C(=Cc2cnc(NC(=O)C3CC3)s2)S1 |
| InChI | InChI=1S/C25H26N4O5S2/c1-13-10-17(34-16-6-4-15(5-7-16)23(32)33)8-9-19(13)27-25-29-22(31)20(36-25)11-18-12-26-24(35-18)28-21(30)14-2-3-14/h8-12,14-16H,2-7H2,1H3,(H,32,33)(H,26,28,30)(H,27,29,31) |
| InChIKey | LSSUSHNHPDMLMU-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 129.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.64 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'ene_rhod_C(13)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|