C19H23N4O3+ — CID 137157076
4-(1-ethyl-2H-tetrazol-1-ium-5-yl)-6-(2-methoxy-5-propan-2-ylphenyl)benzene-1,3-diol (PubChem CID 137157076) has the molecular formula C19H23N4O3+ and a molecular weight of 355.42 g/mol. Its IUPAC name is 4-(1-ethyl-2H-tetrazol-1-ium-5-yl)-6-(2-methoxy-5-propan-2-ylphenyl)benzene-1,3-diol.
| Compound Name | 4-(1-ethyl-2H-tetrazol-1-ium-5-yl)-6-(2-methoxy-5-propan-2-ylphenyl)benzene-1,3-diol |
|---|---|
| PubChem CID | 137157076 |
| Molecular Formula | C19H23N4O3+ |
| Molecular Weight | 355.42 g/mol |
| Exact Mass | 355.18 |
| IUPAC Name | 4-(1-ethyl-2H-tetrazol-1-ium-5-yl)-6-(2-methoxy-5-propan-2-ylphenyl)benzene-1,3-diol |
| SMILES | CC[n+]1[nH]nnc1-c1cc(-c2cc(C(C)C)ccc2OC)c(O)cc1O |
| InChI | InChI=1S/C19H22N4O3/c1-5-23-19(20-21-22-23)15-9-13(16(24)10-17(15)25)14-8-12(11(2)3)6-7-18(14)26-4/h6-11H,5H2,1-4H3,(H2,20,22,24,25)/p+1 |
| InChIKey | FSWANQPTXJEMNG-UHFFFAOYSA-O |
| XLogP | 2.99 |
| TPSA | 95.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.42 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|