C17H20N8S — CID 137157142
3-methyl-N-[[3-(4,5,6,8,10-pentazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaen-3-yl)piperidin-1-yl]methyl]-1,2-thiazol-5-amine (PubChem CID 137157142) has the molecular formula C17H20N8S and a molecular weight of 368.47 g/mol. Its IUPAC name is 3-methyl-N-[[3-(4,5,6,8,10-pentazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaen-3-yl)piperidin-1-yl]methyl]-1,2-thiazol-5-amine.
| Compound Name | 3-methyl-N-[[3-(4,5,6,8,10-pentazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaen-3-yl)piperidin-1-yl]methyl]-1,2-thiazol-5-amine |
|---|---|
| PubChem CID | 137157142 |
| Molecular Formula | C17H20N8S |
| Molecular Weight | 368.47 g/mol |
| Exact Mass | 368.15 |
| IUPAC Name | 3-methyl-N-[[3-(4,5,6,8,10-pentazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaen-3-yl)piperidin-1-yl]methyl]-1,2-thiazol-5-amine |
| SMILES | Cc1cc(NCN2CCCC(c3nnn4cnc5[nH]ccc5c34)C2)sn1 |
| InChI | InChI=1S/C17H20N8S/c1-11-7-14(26-22-11)19-9-24-6-2-3-12(8-24)15-16-13-4-5-18-17(13)20-10-25(16)23-21-15/h4-5,7,10,12,18-19H,2-3,6,8-9H2,1H3 |
| InChIKey | DFKOXTQYWYCCPM-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 87.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.47 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |