About 6-(1-aminoethyl)-3-methyl-4H-1,2,4-triazin-5-one
6-(1-aminoethyl)-3-methyl-4H-1,2,4-triazin-5-one (PubChem CID 137158008) has the molecular formula C6H10N4O
and a molecular weight of 154.17 g/mol. Its IUPAC name is 6-(1-aminoethyl)-3-methyl-4H-1,2,4-triazin-5-one.
Molecular Properties
| Compound Name | 6-(1-aminoethyl)-3-methyl-4H-1,2,4-triazin-5-one |
| PubChem CID | 137158008 |
| Molecular Formula | C6H10N4O |
| Molecular Weight | 154.17 g/mol |
| Exact Mass | 154.09 |
| IUPAC Name | 6-(1-aminoethyl)-3-methyl-4H-1,2,4-triazin-5-one |
| SMILES | Cc1nnc(C(C)N)c(=O)[nH]1 |
| InChI | InChI=1S/C6H10N4O/c1-3(7)5-6(11)8-4(2)9-10-5/h3H,7H2,1-2H3,(H,8,9,11) |
| InChIKey | COUSYCXDUDVHBV-UHFFFAOYSA-N |
| XLogP | -0.51 |
| TPSA | 84.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 154.17 |
| LogP ≤ 5 | -0.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 6-(1-aminoethyl)-3-methyl-4H-1,2,4-triazin-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(1-aminoethyl)-3-methyl-4H-1,2,4-triazin-5-one?
The IUPAC name of 6-(1-aminoethyl)-3-methyl-4H-1,2,4-triazin-5-one (CID 137158008) is 6-(1-aminoethyl)-3-methyl-4H-1,2,4-triazin-5-one.
What is the SMILES notation for 6-(1-aminoethyl)-3-methyl-4H-1,2,4-triazin-5-one?
The canonical SMILES for 6-(1-aminoethyl)-3-methyl-4H-1,2,4-triazin-5-one is Cc1nnc(C(C)N)c(=O)[nH]1.
What is the InChIKey of 6-(1-aminoethyl)-3-methyl-4H-1,2,4-triazin-5-one?
The InChIKey is COUSYCXDUDVHBV-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H10N4O/c1-3(7)5-6(11)8-4(2)9-10-5/h3H,7H2,1-2H3,(H,8,9,11).
What are the key properties of 6-(1-aminoethyl)-3-methyl-4H-1,2,4-triazin-5-one?
6-(1-aminoethyl)-3-methyl-4H-1,2,4-triazin-5-one has a molecular weight of 154.17 g/mol, XLogP of -0.51, 1 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(1-aminoethyl)-3-methyl-4H-1,2,4-triazin-5-one is sourced from PubChem (CID 137158008), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).