C21H17N3O3 — CID 137158163
4-[(3,4-dihydroxyphenyl)diazenyl]-N-(4-ethenylphenyl)benzamide (PubChem CID 137158163) has the molecular formula C21H17N3O3 and a molecular weight of 359.39 g/mol. Its IUPAC name is 4-[(3,4-dihydroxyphenyl)diazenyl]-N-(4-ethenylphenyl)benzamide.
| Compound Name | 4-[(3,4-dihydroxyphenyl)diazenyl]-N-(4-ethenylphenyl)benzamide |
|---|---|
| PubChem CID | 137158163 |
| Molecular Formula | C21H17N3O3 |
| Molecular Weight | 359.39 g/mol |
| Exact Mass | 359.13 |
| IUPAC Name | 4-[(3,4-dihydroxyphenyl)diazenyl]-N-(4-ethenylphenyl)benzamide |
| SMILES | C=Cc1ccc(NC(=O)c2ccc(/N=N/c3ccc(O)c(O)c3)cc2)cc1 |
| InChI | InChI=1S/C21H17N3O3/c1-2-14-3-7-16(8-4-14)22-21(27)15-5-9-17(10-6-15)23-24-18-11-12-19(25)20(26)13-18/h2-13,25-26H,1H2,(H,22,27)/b24-23+ |
| InChIKey | ZEAXLOVIDOEFFJ-WCWDXBQESA-N |
| XLogP | 5.41 |
| TPSA | 94.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.39 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|