C15H26N4O — CID 137158331
4-cyclohexylimino-1,7-dimethyl-1,3,8-triazaspiro[4.5]decan-2-one (PubChem CID 137158331) has the molecular formula C15H26N4O and a molecular weight of 278.40 g/mol. Its IUPAC name is 4-cyclohexylimino-1,7-dimethyl-1,3,8-triazaspiro[4.5]decan-2-one.
| Compound Name | 4-cyclohexylimino-1,7-dimethyl-1,3,8-triazaspiro[4.5]decan-2-one |
|---|---|
| PubChem CID | 137158331 |
| Molecular Formula | C15H26N4O |
| Molecular Weight | 278.40 g/mol |
| Exact Mass | 278.21 |
| IUPAC Name | 4-cyclohexylimino-1,7-dimethyl-1,3,8-triazaspiro[4.5]decan-2-one |
| SMILES | CC1CC2(CCN1)/C(=N/C1CCCCC1)NC(=O)N2C |
| InChI | InChI=1S/C15H26N4O/c1-11-10-15(8-9-16-11)13(18-14(20)19(15)2)17-12-6-4-3-5-7-12/h11-12,16H,3-10H2,1-2H3,(H,17,18,20) |
| InChIKey | HNWZIQGXGKZADG-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.40 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|