C18H19F3N6O — CID 137158623
6-methyl-1-(5,7,10,11-tetrazatricyclo[7.4.0.02,6]trideca-1(13),2,4,6,8,11-hexaen-13-yl)-N-(2,2,2-trifluoroethyl)piperidine-3-carboxamide (PubChem CID 137158623) has the molecular formula C18H19F3N6O and a molecular weight of 392.39 g/mol. Its IUPAC name is 6-methyl-1-(5,7,10,11-tetrazatricyclo[7.4.0.02,6]trideca-1(13),2,4,6,8,11-hexaen-13-yl)-N-(2,2,2-trifluoroethyl)piperidine-3-carboxamide.
| Compound Name | 6-methyl-1-(5,7,10,11-tetrazatricyclo[7.4.0.02,6]trideca-1(13),2,4,6,8,11-hexaen-13-yl)-N-(2,2,2-trifluoroethyl)piperidine-3-carboxamide |
|---|---|
| PubChem CID | 137158623 |
| Molecular Formula | C18H19F3N6O |
| Molecular Weight | 392.39 g/mol |
| Exact Mass | 392.16 |
| IUPAC Name | 6-methyl-1-(5,7,10,11-tetrazatricyclo[7.4.0.02,6]trideca-1(13),2,4,6,8,11-hexaen-13-yl)-N-(2,2,2-trifluoroethyl)piperidine-3-carboxamide |
| SMILES | CC1CCC(C(=O)NCC(F)(F)F)CN1c1cn[nH]c2cnc3nccc3c12 |
| InChI | InChI=1S/C18H19F3N6O/c1-10-2-3-11(17(28)24-9-18(19,20)21)8-27(10)14-7-25-26-13-6-23-16-12(15(13)14)4-5-22-16/h4-7,10-11,26H,2-3,8-9H2,1H3,(H,24,28) |
| InChIKey | OHTGENAEZHWDJH-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 86.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.39 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |