C4H5N5S — CID 137159184
1,5-dihydroimidazo[4,5-c][1,2,6]thiadiazin-4-amine (PubChem CID 137159184) has the molecular formula C4H5N5S and a molecular weight of 155.19 g/mol. Its IUPAC name is 1,5-dihydroimidazo[4,5-c][1,2,6]thiadiazin-4-amine.
| Compound Name | 1,5-dihydroimidazo[4,5-c][1,2,6]thiadiazin-4-amine |
|---|---|
| PubChem CID | 137159184 |
| Molecular Formula | C4H5N5S |
| Molecular Weight | 155.19 g/mol |
| Exact Mass | 155.03 |
| IUPAC Name | 1,5-dihydroimidazo[4,5-c][1,2,6]thiadiazin-4-amine |
| SMILES | NC1=NSNc2nc[nH]c21 |
| InChI | InChI=1S/C4H5N5S/c5-3-2-4(7-1-6-2)9-10-8-3/h1,9H,(H2,5,8)(H,6,7) |
| InChIKey | KHITWQQQOITKOY-UHFFFAOYSA-N |
| XLogP | 0.10 |
| TPSA | 79.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 155.19 |
| LogP ≤ 5 | 0.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|