C23H33N7O2 — CID 137159929
3-[6-(1-cyclobutylethylamino)-7-(6-methylnon-8-en-2-yl)purin-2-yl]-4H-1,2,4-oxadiazol-5-one (PubChem CID 137159929) has the molecular formula C23H33N7O2 and a molecular weight of 439.56 g/mol. Its IUPAC name is 3-[6-(1-cyclobutylethylamino)-7-(6-methylnon-8-en-2-yl)purin-2-yl]-4H-1,2,4-oxadiazol-5-one.
| Compound Name | 3-[6-(1-cyclobutylethylamino)-7-(6-methylnon-8-en-2-yl)purin-2-yl]-4H-1,2,4-oxadiazol-5-one |
|---|---|
| PubChem CID | 137159929 |
| Molecular Formula | C23H33N7O2 |
| Molecular Weight | 439.56 g/mol |
| Exact Mass | 439.27 |
| IUPAC Name | 3-[6-(1-cyclobutylethylamino)-7-(6-methylnon-8-en-2-yl)purin-2-yl]-4H-1,2,4-oxadiazol-5-one |
| SMILES | C=CCC(C)CCCC(C)n1cnc2nc(-c3noc(=O)[nH]3)nc(NC(C)C3CCC3)c21 |
| InChI | InChI=1S/C23H33N7O2/c1-5-8-14(2)9-6-10-15(3)30-13-24-19-18(30)20(25-16(4)17-11-7-12-17)27-21(26-19)22-28-23(31)32-29-22/h5,13-17H,1,6-12H2,2-4H3,(H,25,26,27)(H,28,29,31) |
| InChIKey | NHIDDUMFQUFRCX-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 114.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.56 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|