About 4-[6-(fluoromethyl)-1H-pyrazolo[4,3-b]pyridin-3-yl]phenol
4-[6-(fluoromethyl)-1H-pyrazolo[4,3-b]pyridin-3-yl]phenol (PubChem CID 137159976) has the molecular formula C13H10FN3O
and a molecular weight of 243.24 g/mol. Its IUPAC name is 4-[6-(fluoromethyl)-1H-pyrazolo[4,3-b]pyridin-3-yl]phenol.
Molecular Properties
| Compound Name | 4-[6-(fluoromethyl)-1H-pyrazolo[4,3-b]pyridin-3-yl]phenol |
| PubChem CID | 137159976 |
| Molecular Formula | C13H10FN3O |
| Molecular Weight | 243.24 g/mol |
| Exact Mass | 243.08 |
| IUPAC Name | 4-[6-(fluoromethyl)-1H-pyrazolo[4,3-b]pyridin-3-yl]phenol |
| SMILES | Oc1ccc(-c2n[nH]c3cc(CF)cnc23)cc1 |
| InChI | InChI=1S/C13H10FN3O/c14-6-8-5-11-13(15-7-8)12(17-16-11)9-1-3-10(18)4-2-9/h1-5,7,18H,6H2,(H,16,17) |
| InChIKey | YJNBMEHSTVDKOK-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 61.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 243.24 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-[6-(fluoromethyl)-1H-pyrazolo[4,3-b]pyridin-3-yl]phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[6-(fluoromethyl)-1H-pyrazolo[4,3-b]pyridin-3-yl]phenol?
The IUPAC name of 4-[6-(fluoromethyl)-1H-pyrazolo[4,3-b]pyridin-3-yl]phenol (CID 137159976) is 4-[6-(fluoromethyl)-1H-pyrazolo[4,3-b]pyridin-3-yl]phenol.
What is the SMILES notation for 4-[6-(fluoromethyl)-1H-pyrazolo[4,3-b]pyridin-3-yl]phenol?
The canonical SMILES for 4-[6-(fluoromethyl)-1H-pyrazolo[4,3-b]pyridin-3-yl]phenol is Oc1ccc(-c2n[nH]c3cc(CF)cnc23)cc1.
What is the InChIKey of 4-[6-(fluoromethyl)-1H-pyrazolo[4,3-b]pyridin-3-yl]phenol?
The InChIKey is YJNBMEHSTVDKOK-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H10FN3O/c14-6-8-5-11-13(15-7-8)12(17-16-11)9-1-3-10(18)4-2-9/h1-5,7,18H,6H2,(H,16,17).
What are the key properties of 4-[6-(fluoromethyl)-1H-pyrazolo[4,3-b]pyridin-3-yl]phenol?
4-[6-(fluoromethyl)-1H-pyrazolo[4,3-b]pyridin-3-yl]phenol has a molecular weight of 243.24 g/mol, XLogP of 2.80, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[6-(fluoromethyl)-1H-pyrazolo[4,3-b]pyridin-3-yl]phenol is sourced from PubChem (CID 137159976), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).