About (E)-2-(4,5-dihydro-1H-imidazol-2-yl)-3-hydroxybut-2-enamide
(E)-2-(4,5-dihydro-1H-imidazol-2-yl)-3-hydroxybut-2-enamide (PubChem CID 137159990) has the molecular formula C7H11N3O2
and a molecular weight of 169.18 g/mol. Its IUPAC name is (E)-2-(4,5-dihydro-1H-imidazol-2-yl)-3-hydroxybut-2-enamide.
Molecular Properties
| Compound Name | (E)-2-(4,5-dihydro-1H-imidazol-2-yl)-3-hydroxybut-2-enamide |
| PubChem CID | 137159990 |
| Molecular Formula | C7H11N3O2 |
| Molecular Weight | 169.18 g/mol |
| Exact Mass | 169.09 |
| IUPAC Name | (E)-2-(4,5-dihydro-1H-imidazol-2-yl)-3-hydroxybut-2-enamide |
| SMILES | C/C(O)=C(\C(N)=O)C1=NCCN1 |
| InChI | InChI=1S/C7H11N3O2/c1-4(11)5(6(8)12)7-9-2-3-10-7/h11H,2-3H2,1H3,(H2,8,12)(H,9,10)/b5-4- |
| InChIKey | VBOSABPWKORDJB-PLNGDYQASA-N |
| XLogP | -0.69 |
| TPSA | 87.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 169.18 |
| LogP ≤ 5 | -0.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (E)-2-(4,5-dihydro-1H-imidazol-2-yl)-3-hydroxybut-2-enamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-2-(4,5-dihydro-1H-imidazol-2-yl)-3-hydroxybut-2-enamide?
The IUPAC name of (E)-2-(4,5-dihydro-1H-imidazol-2-yl)-3-hydroxybut-2-enamide (CID 137159990) is (E)-2-(4,5-dihydro-1H-imidazol-2-yl)-3-hydroxybut-2-enamide.
What is the SMILES notation for (E)-2-(4,5-dihydro-1H-imidazol-2-yl)-3-hydroxybut-2-enamide?
The canonical SMILES for (E)-2-(4,5-dihydro-1H-imidazol-2-yl)-3-hydroxybut-2-enamide is C/C(O)=C(\C(N)=O)C1=NCCN1.
What is the InChIKey of (E)-2-(4,5-dihydro-1H-imidazol-2-yl)-3-hydroxybut-2-enamide?
The InChIKey is VBOSABPWKORDJB-PLNGDYQASA-N. The full InChI is InChI=1S/C7H11N3O2/c1-4(11)5(6(8)12)7-9-2-3-10-7/h11H,2-3H2,1H3,(H2,8,12)(H,9,10)/b5-4-.
What are the key properties of (E)-2-(4,5-dihydro-1H-imidazol-2-yl)-3-hydroxybut-2-enamide?
(E)-2-(4,5-dihydro-1H-imidazol-2-yl)-3-hydroxybut-2-enamide has a molecular weight of 169.18 g/mol, XLogP of -0.69, 2 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-2-(4,5-dihydro-1H-imidazol-2-yl)-3-hydroxybut-2-enamide is sourced from PubChem (CID 137159990), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).