About 2H-benzotriazol-4-ol;tetrabutylazanium
2H-benzotriazol-4-ol;tetrabutylazanium (PubChem CID 137160229) has the molecular formula C22H41N4O+
and a molecular weight of 377.60 g/mol. Its IUPAC name is 2H-benzotriazol-4-ol;tetrabutylazanium.
Molecular Properties
| Compound Name | 2H-benzotriazol-4-ol;tetrabutylazanium |
| PubChem CID | 137160229 |
| Molecular Formula | C22H41N4O+ |
| Molecular Weight | 377.60 g/mol |
| Exact Mass | 377.33 |
| IUPAC Name | 2H-benzotriazol-4-ol;tetrabutylazanium |
| SMILES | CCCC[N+](CCCC)(CCCC)CCCC.Oc1cccc2n[nH]nc12 |
| InChI | InChI=1S/C16H36N.C6H5N3O/c1-5-9-13-17(14-10-6-2,15-11-7-3)16-12-8-4;10-5-3-1-2-4-6(5)8-9-7-4/h5-16H2,1-4H3;1-3,10H,(H,7,8,9)/q+1; |
| InChIKey | HMKOLAVZNIBSPO-UHFFFAOYSA-N |
| XLogP | 5.67 |
| TPSA | 61.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 377.60 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze 2H-benzotriazol-4-ol;tetrabutylazanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2H-benzotriazol-4-ol;tetrabutylazanium?
The IUPAC name of 2H-benzotriazol-4-ol;tetrabutylazanium (CID 137160229) is 2H-benzotriazol-4-ol;tetrabutylazanium.
What is the SMILES notation for 2H-benzotriazol-4-ol;tetrabutylazanium?
The canonical SMILES for 2H-benzotriazol-4-ol;tetrabutylazanium is CCCC[N+](CCCC)(CCCC)CCCC.Oc1cccc2n[nH]nc12.
What is the InChIKey of 2H-benzotriazol-4-ol;tetrabutylazanium?
The InChIKey is HMKOLAVZNIBSPO-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H36N.C6H5N3O/c1-5-9-13-17(14-10-6-2,15-11-7-3)16-12-8-4;10-5-3-1-2-4-6(5)8-9-7-4/h5-16H2,1-4H3;1-3,10H,(H,7,8,9)/q+1;.
What are the key properties of 2H-benzotriazol-4-ol;tetrabutylazanium?
2H-benzotriazol-4-ol;tetrabutylazanium has a molecular weight of 377.60 g/mol, XLogP of 5.67, 12 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2H-benzotriazol-4-ol;tetrabutylazanium is sourced from PubChem (CID 137160229), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).