C14H15BFN3O2 — CID 137160921
ethyl 3-[(2-fluoro-1,3-diaza-2-boratricyclo[7.3.0.03,7]dodeca-4,6,9,11-tetraen-8-ylidene)amino]propanoate (PubChem CID 137160921) has the molecular formula C14H15BFN3O2 and a molecular weight of 287.10 g/mol. Its IUPAC name is ethyl 3-[(2-fluoro-1,3-diaza-2-boratricyclo[7.3.0.03,7]dodeca-4,6,9,11-tetraen-8-ylidene)amino]propanoate.
| Compound Name | ethyl 3-[(2-fluoro-1,3-diaza-2-boratricyclo[7.3.0.03,7]dodeca-4,6,9,11-tetraen-8-ylidene)amino]propanoate |
|---|---|
| PubChem CID | 137160921 |
| Molecular Formula | C14H15BFN3O2 |
| Molecular Weight | 287.10 g/mol |
| Exact Mass | 287.12 |
| IUPAC Name | ethyl 3-[(2-fluoro-1,3-diaza-2-boratricyclo[7.3.0.03,7]dodeca-4,6,9,11-tetraen-8-ylidene)amino]propanoate |
| SMILES | CCOC(=O)CCN=C1c2cccn2B(F)n2cccc21 |
| InChI | InChI=1S/C14H15BFN3O2/c1-2-21-13(20)7-8-17-14-11-5-3-9-18(11)15(16)19-10-4-6-12(14)19/h3-6,9-10H,2,7-8H2,1H3 |
| InChIKey | JONSIJIYZZALKY-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 48.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.10 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|