C24H25N7O3 — CID 137161349
5-[[8-(cyclopropylamino)-6-[3-(morpholin-4-ylmethyl)phenyl]imidazo[1,2-a]pyrazin-3-yl]methylidene]imidazolidine-2,4-dione (PubChem CID 137161349) has the molecular formula C24H25N7O3 and a molecular weight of 459.51 g/mol. Its IUPAC name is 5-[[8-(cyclopropylamino)-6-[3-(morpholin-4-ylmethyl)phenyl]imidazo[1,2-a]pyrazin-3-yl]methylidene]imidazolidine-2,4-dione.
| Compound Name | 5-[[8-(cyclopropylamino)-6-[3-(morpholin-4-ylmethyl)phenyl]imidazo[1,2-a]pyrazin-3-yl]methylidene]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 137161349 |
| Molecular Formula | C24H25N7O3 |
| Molecular Weight | 459.51 g/mol |
| Exact Mass | 459.20 |
| IUPAC Name | 5-[[8-(cyclopropylamino)-6-[3-(morpholin-4-ylmethyl)phenyl]imidazo[1,2-a]pyrazin-3-yl]methylidene]imidazolidine-2,4-dione |
| SMILES | O=C1NC(=O)C(=Cc2cnc3c(NC4CC4)nc(-c4cccc(CN5CCOCC5)c4)cn23)N1 |
| InChI | InChI=1S/C24H25N7O3/c32-23-19(28-24(33)29-23)11-18-12-25-22-21(26-17-4-5-17)27-20(14-31(18)22)16-3-1-2-15(10-16)13-30-6-8-34-9-7-30/h1-3,10-12,14,17H,4-9,13H2,(H,26,27)(H2,28,29,32,33) |
| InChIKey | XAOCMDKIMLJEMO-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 112.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.51 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|