C12H11N5O3 — CID 137161500
2-[[(6-methyl-5-oxo-4H-1,2,4-triazin-3-yl)diazenyl]methyl]benzoic acid (PubChem CID 137161500) has the molecular formula C12H11N5O3 and a molecular weight of 273.25 g/mol. Its IUPAC name is 2-[[(6-methyl-5-oxo-4H-1,2,4-triazin-3-yl)diazenyl]methyl]benzoic acid.
| Compound Name | 2-[[(6-methyl-5-oxo-4H-1,2,4-triazin-3-yl)diazenyl]methyl]benzoic acid |
|---|---|
| PubChem CID | 137161500 |
| Molecular Formula | C12H11N5O3 |
| Molecular Weight | 273.25 g/mol |
| Exact Mass | 273.09 |
| IUPAC Name | 2-[[(6-methyl-5-oxo-4H-1,2,4-triazin-3-yl)diazenyl]methyl]benzoic acid |
| SMILES | Cc1nnc(/N=N/Cc2ccccc2C(=O)O)[nH]c1=O |
| InChI | InChI=1S/C12H11N5O3/c1-7-10(18)14-12(17-15-7)16-13-6-8-4-2-3-5-9(8)11(19)20/h2-5H,6H2,1H3,(H,19,20)(H,14,17,18)/b16-13+ |
| InChIKey | QSSKSLJZDKDNBW-DTQAZKPQSA-N |
| XLogP | 1.46 |
| TPSA | 120.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.25 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|