About sodium hydroxy-(7-oxopyrazolo[1,5-a]pyrimidin-6-ylidene)methanolate
sodium hydroxy-(7-oxopyrazolo[1,5-a]pyrimidin-6-ylidene)methanolate (PubChem CID 137161938) has the molecular formula C7H4N3NaO3
and a molecular weight of 201.12 g/mol. Its IUPAC name is sodium hydroxy-(7-oxopyrazolo[1,5-a]pyrimidin-6-ylidene)methanolate.
Molecular Properties
| Compound Name | sodium hydroxy-(7-oxopyrazolo[1,5-a]pyrimidin-6-ylidene)methanolate |
| PubChem CID | 137161938 |
| Molecular Formula | C7H4N3NaO3 |
| Molecular Weight | 201.12 g/mol |
| Exact Mass | 201.02 |
| IUPAC Name | sodium hydroxy-(7-oxopyrazolo[1,5-a]pyrimidin-6-ylidene)methanolate |
| SMILES | O=c1c(=C([O-])O)cnc2ccnn12.[Na+] |
| InChI | InChI=1S/C7H5N3O3.Na/c11-6-4(7(12)13)3-8-5-1-2-9-10(5)6;/h1-3,12-13H;/q;+1/p-1 |
| InChIKey | VDUQSFZHCCIRRO-UHFFFAOYSA-M |
| XLogP | -5.20 |
| TPSA | 90.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 201.12 |
| LogP ≤ 5 | -5.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze sodium hydroxy-(7-oxopyrazolo[1,5-a]pyrimidin-6-ylidene)methanolate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium hydroxy-(7-oxopyrazolo[1,5-a]pyrimidin-6-ylidene)methanolate?
The IUPAC name of sodium hydroxy-(7-oxopyrazolo[1,5-a]pyrimidin-6-ylidene)methanolate (CID 137161938) is sodium hydroxy-(7-oxopyrazolo[1,5-a]pyrimidin-6-ylidene)methanolate.
What is the SMILES notation for sodium hydroxy-(7-oxopyrazolo[1,5-a]pyrimidin-6-ylidene)methanolate?
The canonical SMILES for sodium hydroxy-(7-oxopyrazolo[1,5-a]pyrimidin-6-ylidene)methanolate is O=c1c(=C([O-])O)cnc2ccnn12.[Na+].
What is the InChIKey of sodium hydroxy-(7-oxopyrazolo[1,5-a]pyrimidin-6-ylidene)methanolate?
The InChIKey is VDUQSFZHCCIRRO-UHFFFAOYSA-M. The full InChI is InChI=1S/C7H5N3O3.Na/c11-6-4(7(12)13)3-8-5-1-2-9-10(5)6;/h1-3,12-13H;/q;+1/p-1.
What are the key properties of sodium hydroxy-(7-oxopyrazolo[1,5-a]pyrimidin-6-ylidene)methanolate?
sodium hydroxy-(7-oxopyrazolo[1,5-a]pyrimidin-6-ylidene)methanolate has a molecular weight of 201.12 g/mol, XLogP of -5.20, 0 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for sodium hydroxy-(7-oxopyrazolo[1,5-a]pyrimidin-6-ylidene)methanolate is sourced from PubChem (CID 137161938), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).